C24H21NO2 — CID 66637000
7-methyl-5-(2-phenylethyl)-7,8-dihydro-6H-indeno[1,2-b]indole-9,10-dione (PubChem CID 66637000) has the molecular formula C24H21NO2 and a molecular weight of 355.44 g/mol. Its IUPAC name is 7-methyl-5-(2-phenylethyl)-7,8-dihydro-6H-indeno[1,2-b]indole-9,10-dione.
| Compound Name | 7-methyl-5-(2-phenylethyl)-7,8-dihydro-6H-indeno[1,2-b]indole-9,10-dione |
|---|---|
| PubChem CID | 66637000 |
| Molecular Formula | C24H21NO2 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.16 |
| IUPAC Name | 7-methyl-5-(2-phenylethyl)-7,8-dihydro-6H-indeno[1,2-b]indole-9,10-dione |
| SMILES | CC1CC(=O)c2c3c(n(CCc4ccccc4)c2C1)-c1ccccc1C3=O |
| InChI | InChI=1S/C24H21NO2/c1-15-13-19-21(20(26)14-15)22-23(17-9-5-6-10-18(17)24(22)27)25(19)12-11-16-7-3-2-4-8-16/h2-10,15H,11-14H2,1H3 |
| InChIKey | ZVASCVRKMXOAJR-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_O(1)', 'substructure': 'N/A'} |
|---|