C23H17ClFN3O2 — CID 66637595
N-[(3-chlorophenyl)methyl]-3-[(2-fluorophenyl)methyl]-4-oxoquinazoline-7-carboxamide (PubChem CID 66637595) has the molecular formula C23H17ClFN3O2 and a molecular weight of 421.86 g/mol. Its IUPAC name is N-[(3-chlorophenyl)methyl]-3-[(2-fluorophenyl)methyl]-4-oxoquinazoline-7-carboxamide.
| Compound Name | N-[(3-chlorophenyl)methyl]-3-[(2-fluorophenyl)methyl]-4-oxoquinazoline-7-carboxamide |
|---|---|
| PubChem CID | 66637595 |
| Molecular Formula | C23H17ClFN3O2 |
| Molecular Weight | 421.86 g/mol |
| Exact Mass | 421.10 |
| IUPAC Name | N-[(3-chlorophenyl)methyl]-3-[(2-fluorophenyl)methyl]-4-oxoquinazoline-7-carboxamide |
| SMILES | O=C(NCc1cccc(Cl)c1)c1ccc2c(=O)n(Cc3ccccc3F)cnc2c1 |
| InChI | InChI=1S/C23H17ClFN3O2/c24-18-6-3-4-15(10-18)12-26-22(29)16-8-9-19-21(11-16)27-14-28(23(19)30)13-17-5-1-2-7-20(17)25/h1-11,14H,12-13H2,(H,26,29) |
| InChIKey | JUHHGJWVOVNGBY-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.86 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |