About methyl 2-[(E,3R)-3-(dibenzylamino)-4-(2-fluorophenyl)but-1-enyl]pyridine-3-carboxylate
methyl 2-[(E,3R)-3-(dibenzylamino)-4-(2-fluorophenyl)but-1-enyl]pyridine-3-carboxylate (PubChem CID 66638929) has the molecular formula C31H29FN2O2
and a molecular weight of 480.58 g/mol. Its IUPAC name is methyl 2-[(E,3R)-3-(dibenzylamino)-4-(2-fluorophenyl)but-1-enyl]pyridine-3-carboxylate.
Molecular Properties
| Compound Name | methyl 2-[(E,3R)-3-(dibenzylamino)-4-(2-fluorophenyl)but-1-enyl]pyridine-3-carboxylate |
| PubChem CID | 66638929 |
| Molecular Formula | C31H29FN2O2 |
| Molecular Weight | 480.58 g/mol |
| Exact Mass | 480.22 |
| IUPAC Name | methyl 2-[(E,3R)-3-(dibenzylamino)-4-(2-fluorophenyl)but-1-enyl]pyridine-3-carboxylate |
| SMILES | COC(=O)c1cccnc1/C=C/[C@@H](Cc1ccccc1F)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C31H29FN2O2/c1-36-31(35)28-16-10-20-33-30(28)19-18-27(21-26-15-8-9-17-29(26)32)34(22-24-11-4-2-5-12-24)23-25-13-6-3-7-14-25/h2-20,27H,21-23H2,1H3/b19-18+/t27-/m0/s1 |
| InChIKey | OSLQVFXXINFZAT-ZAFHEYGESA-N |
| XLogP | 6.33 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 480.58 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 2-[(E,3R)-3-(dibenzylamino)-4-(2-fluorophenyl)but-1-enyl]pyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[(E,3R)-3-(dibenzylamino)-4-(2-fluorophenyl)but-1-enyl]pyridine-3-carboxylate?
The IUPAC name of methyl 2-[(E,3R)-3-(dibenzylamino)-4-(2-fluorophenyl)but-1-enyl]pyridine-3-carboxylate (CID 66638929) is methyl 2-[(E,3R)-3-(dibenzylamino)-4-(2-fluorophenyl)but-1-enyl]pyridine-3-carboxylate.
What is the SMILES notation for methyl 2-[(E,3R)-3-(dibenzylamino)-4-(2-fluorophenyl)but-1-enyl]pyridine-3-carboxylate?
The canonical SMILES for methyl 2-[(E,3R)-3-(dibenzylamino)-4-(2-fluorophenyl)but-1-enyl]pyridine-3-carboxylate is COC(=O)c1cccnc1/C=C/[C@@H](Cc1ccccc1F)N(Cc1ccccc1)Cc1ccccc1.
What is the InChIKey of methyl 2-[(E,3R)-3-(dibenzylamino)-4-(2-fluorophenyl)but-1-enyl]pyridine-3-carboxylate?
The InChIKey is OSLQVFXXINFZAT-ZAFHEYGESA-N. The full InChI is InChI=1S/C31H29FN2O2/c1-36-31(35)28-16-10-20-33-30(28)19-18-27(21-26-15-8-9-17-29(26)32)34(22-24-11-4-2-5-12-24)23-25-13-6-3-7-14-25/h2-20,27H,21-23H2,1H3/b19-18+/t27-/m0/s1.
What are the key properties of methyl 2-[(E,3R)-3-(dibenzylamino)-4-(2-fluorophenyl)but-1-enyl]pyridine-3-carboxylate?
methyl 2-[(E,3R)-3-(dibenzylamino)-4-(2-fluorophenyl)but-1-enyl]pyridine-3-carboxylate has a molecular weight of 480.58 g/mol, XLogP of 6.33, 10 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[(E,3R)-3-(dibenzylamino)-4-(2-fluorophenyl)but-1-enyl]pyridine-3-carboxylate is sourced from PubChem (CID 66638929), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).