C23H23F2NO — CID 66639249
(2R)-2-(dibenzylamino)-3-(2,5-difluorophenyl)propan-1-ol (PubChem CID 66639249) has the molecular formula C23H23F2NO and a molecular weight of 367.44 g/mol. Its IUPAC name is (2R)-2-(dibenzylamino)-3-(2,5-difluorophenyl)propan-1-ol.
| Compound Name | (2R)-2-(dibenzylamino)-3-(2,5-difluorophenyl)propan-1-ol |
|---|---|
| PubChem CID | 66639249 |
| Molecular Formula | C23H23F2NO |
| Molecular Weight | 367.44 g/mol |
| Exact Mass | 367.17 |
| IUPAC Name | (2R)-2-(dibenzylamino)-3-(2,5-difluorophenyl)propan-1-ol |
| SMILES | OC[C@@H](Cc1cc(F)ccc1F)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C23H23F2NO/c24-21-11-12-23(25)20(13-21)14-22(17-27)26(15-18-7-3-1-4-8-18)16-19-9-5-2-6-10-19/h1-13,22,27H,14-17H2/t22-/m1/s1 |
| InChIKey | QVJJRCALQAHYLI-JOCHJYFZSA-N |
| XLogP | 4.57 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.44 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |