About 3,4-diethyl-2-hexoxyphenol;2-methoxyphenol;triazine
3,4-diethyl-2-hexoxyphenol;2-methoxyphenol;triazine (PubChem CID 66639258) has the molecular formula C26H37N3O4
and a molecular weight of 455.60 g/mol. Its IUPAC name is 3,4-diethyl-2-hexoxyphenol;2-methoxyphenol;triazine.
Molecular Properties
| Compound Name | 3,4-diethyl-2-hexoxyphenol;2-methoxyphenol;triazine |
| PubChem CID | 66639258 |
| Molecular Formula | C26H37N3O4 |
| Molecular Weight | 455.60 g/mol |
| Exact Mass | 455.28 |
| IUPAC Name | 3,4-diethyl-2-hexoxyphenol;2-methoxyphenol;triazine |
| SMILES | CCCCCCOc1c(O)ccc(CC)c1CC.COc1ccccc1O.c1cnnnc1 |
| InChI | InChI=1S/C16H26O2.C7H8O2.C3H3N3/c1-4-7-8-9-12-18-16-14(6-3)13(5-2)10-11-15(16)17;1-9-7-5-3-2-4-6(7)8;1-2-4-6-5-3-1/h10-11,17H,4-9,12H2,1-3H3;2-5,8H,1H3;1-3H |
| InChIKey | GMUDCCCPVSCMPS-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 97.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 455.60 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3,4-diethyl-2-hexoxyphenol;2-methoxyphenol;triazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-diethyl-2-hexoxyphenol;2-methoxyphenol;triazine?
The IUPAC name of 3,4-diethyl-2-hexoxyphenol;2-methoxyphenol;triazine (CID 66639258) is 3,4-diethyl-2-hexoxyphenol;2-methoxyphenol;triazine.
What is the SMILES notation for 3,4-diethyl-2-hexoxyphenol;2-methoxyphenol;triazine?
The canonical SMILES for 3,4-diethyl-2-hexoxyphenol;2-methoxyphenol;triazine is CCCCCCOc1c(O)ccc(CC)c1CC.COc1ccccc1O.c1cnnnc1.
What is the InChIKey of 3,4-diethyl-2-hexoxyphenol;2-methoxyphenol;triazine?
The InChIKey is GMUDCCCPVSCMPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H26O2.C7H8O2.C3H3N3/c1-4-7-8-9-12-18-16-14(6-3)13(5-2)10-11-15(16)17;1-9-7-5-3-2-4-6(7)8;1-2-4-6-5-3-1/h10-11,17H,4-9,12H2,1-3H3;2-5,8H,1H3;1-3H.
What are the key properties of 3,4-diethyl-2-hexoxyphenol;2-methoxyphenol;triazine?
3,4-diethyl-2-hexoxyphenol;2-methoxyphenol;triazine has a molecular weight of 455.60 g/mol, XLogP of 5.75, 9 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-diethyl-2-hexoxyphenol;2-methoxyphenol;triazine is sourced from PubChem (CID 66639258), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).