C13H12BrN3O4S — CID 66639652
methyl 3-[(2-bromophenyl)methylsulfonylamino]pyrazine-2-carboxylate (PubChem CID 66639652) has the molecular formula C13H12BrN3O4S and a molecular weight of 386.23 g/mol. Its IUPAC name is methyl 3-[(2-bromophenyl)methylsulfonylamino]pyrazine-2-carboxylate.
| Compound Name | methyl 3-[(2-bromophenyl)methylsulfonylamino]pyrazine-2-carboxylate |
|---|---|
| PubChem CID | 66639652 |
| Molecular Formula | C13H12BrN3O4S |
| Molecular Weight | 386.23 g/mol |
| Exact Mass | 384.97 |
| IUPAC Name | methyl 3-[(2-bromophenyl)methylsulfonylamino]pyrazine-2-carboxylate |
| SMILES | COC(=O)c1nccnc1NS(=O)(=O)Cc1ccccc1Br |
| InChI | InChI=1S/C13H12BrN3O4S/c1-21-13(18)11-12(16-7-6-15-11)17-22(19,20)8-9-4-2-3-5-10(9)14/h2-7H,8H2,1H3,(H,16,17) |
| InChIKey | TYUPKUJHOANWNO-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 98.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.23 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |