About 2-nitrobenzenesulfonic acid
2-nitrobenzenesulfonic acid (PubChem CID 6664) has the molecular formula C6H5NO5S
and a molecular weight of 203.18 g/mol. Its IUPAC name is 2-nitrobenzenesulfonic acid.
Molecular Properties
| Compound Name | 2-nitrobenzenesulfonic acid |
| PubChem CID | 6664 |
| Molecular Formula | C6H5NO5S |
| Molecular Weight | 203.18 g/mol |
| Exact Mass | 202.99 |
| IUPAC Name | 2-nitrobenzenesulfonic acid |
| SMILES | O=[N+]([O-])c1ccccc1S(=O)(=O)O |
| InChI | InChI=1S/C6H5NO5S/c8-7(9)5-3-1-2-4-6(5)13(10,11)12/h1-4H,(H,10,11,12) |
| InChIKey | HWTDMFJYBAURQR-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 97.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.18 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 2-nitrobenzenesulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-nitrobenzenesulfonic acid?
The IUPAC name of 2-nitrobenzenesulfonic acid (CID 6664) is 2-nitrobenzenesulfonic acid.
What is the SMILES notation for 2-nitrobenzenesulfonic acid?
The canonical SMILES for 2-nitrobenzenesulfonic acid is O=[N+]([O-])c1ccccc1S(=O)(=O)O.
What is the InChIKey of 2-nitrobenzenesulfonic acid?
The InChIKey is HWTDMFJYBAURQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5NO5S/c8-7(9)5-3-1-2-4-6(5)13(10,11)12/h1-4H,(H,10,11,12).
What are the key properties of 2-nitrobenzenesulfonic acid?
2-nitrobenzenesulfonic acid has a molecular weight of 203.18 g/mol, XLogP of 0.84, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-nitrobenzenesulfonic acid is sourced from PubChem (CID 6664), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).