C29H24N2O4 — CID 66640269
ethyl 3-(4-benzoylbenzoyl)-2,6-dihydro-1H-azepino[4,5-b]indole-5-carboxylate (PubChem CID 66640269) has the molecular formula C29H24N2O4 and a molecular weight of 464.52 g/mol. Its IUPAC name is ethyl 3-(4-benzoylbenzoyl)-2,6-dihydro-1H-azepino[4,5-b]indole-5-carboxylate.
| Compound Name | ethyl 3-(4-benzoylbenzoyl)-2,6-dihydro-1H-azepino[4,5-b]indole-5-carboxylate |
|---|---|
| PubChem CID | 66640269 |
| Molecular Formula | C29H24N2O4 |
| Molecular Weight | 464.52 g/mol |
| Exact Mass | 464.17 |
| IUPAC Name | ethyl 3-(4-benzoylbenzoyl)-2,6-dihydro-1H-azepino[4,5-b]indole-5-carboxylate |
| SMILES | CCOC(=O)C1=CN(C(=O)c2ccc(C(=O)c3ccccc3)cc2)CCc2c1[nH]c1ccccc21 |
| InChI | InChI=1S/C29H24N2O4/c1-2-35-29(34)24-18-31(17-16-23-22-10-6-7-11-25(22)30-26(23)24)28(33)21-14-12-20(13-15-21)27(32)19-8-4-3-5-9-19/h3-15,18,30H,2,16-17H2,1H3 |
| InChIKey | HPDNUJZISHKSKR-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 79.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.52 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |