C10H14N4O — CID 666403
5-N,5-N-diethyl-2,1,3-benzoxadiazole-4,5-diamine (PubChem CID 666403) has the molecular formula C10H14N4O and a molecular weight of 206.25 g/mol. Its IUPAC name is 5-N,5-N-diethyl-2,1,3-benzoxadiazole-4,5-diamine.
| Compound Name | 5-N,5-N-diethyl-2,1,3-benzoxadiazole-4,5-diamine |
|---|---|
| PubChem CID | 666403 |
| Molecular Formula | C10H14N4O |
| Molecular Weight | 206.25 g/mol |
| Exact Mass | 206.12 |
| IUPAC Name | 5-N,5-N-diethyl-2,1,3-benzoxadiazole-4,5-diamine |
| SMILES | CCN(CC)c1ccc2nonc2c1N |
| InChI | InChI=1S/C10H14N4O/c1-3-14(4-2)8-6-5-7-10(9(8)11)13-15-12-7/h5-6H,3-4,11H2,1-2H3 |
| InChIKey | GJFQGIDAXKOEEB-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.25 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|