About CID 66641033
CID 66641033 (PubChem CID 66641033) has the molecular formula C46H40N2O6
and a molecular weight of 716.83 g/mol.
Molecular Properties
| Compound Name | CID 66641033 |
| PubChem CID | 66641033 |
| Molecular Formula | C46H40N2O6 |
| Molecular Weight | 716.83 g/mol |
| Exact Mass | 716.29 |
| IUPAC Name | — |
| SMILES | CN1CCC(C)(C)c2c1ccc1c2Oc2cc3c(cc2C12OC(=O)c1ccccc12)C1(OC(=O)c2ccccc21)c1ccc2c(c1O3)C(C)(C)CCN2C |
| InChI | InChI=1S/C46H40N2O6/c1-43(2)19-21-47(5)33-17-15-29-39(37(33)43)51-35-24-36-32(23-31(35)45(29)27-13-9-7-11-25(27)41(49)53-45)46(28-14-10-8-12-26(28)42(50)54-46)30-16-18-34-38(40(30)52-36)44(3,4)20-22-48(34)6/h7-18,23-24H,19-22H2,1-6H3 |
| InChIKey | OPGHGTSKZZNRED-UHFFFAOYSA-N |
| XLogP | 9.06 |
| TPSA | 77.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 54 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 716.83 |
| LogP ≤ 5 | 9.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze CID 66641033 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 66641033?
The IUPAC name of CID 66641033 (CID 66641033) is not available.
What is the SMILES notation for CID 66641033?
The canonical SMILES for CID 66641033 is CN1CCC(C)(C)c2c1ccc1c2Oc2cc3c(cc2C12OC(=O)c1ccccc12)C1(OC(=O)c2ccccc21)c1ccc2c(c1O3)C(C)(C)CCN2C.
What is the InChIKey of CID 66641033?
The InChIKey is OPGHGTSKZZNRED-UHFFFAOYSA-N. The full InChI is InChI=1S/C46H40N2O6/c1-43(2)19-21-47(5)33-17-15-29-39(37(33)43)51-35-24-36-32(23-31(35)45(29)27-13-9-7-11-25(27)41(49)53-45)46(28-14-10-8-12-26(28)42(50)54-46)30-16-18-34-38(40(30)52-36)44(3,4)20-22-48(34)6/h7-18,23-24H,19-22H2,1-6H3.
What are the key properties of CID 66641033?
CID 66641033 has a molecular weight of 716.83 g/mol, XLogP of 9.06, 0 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for CID 66641033 is sourced from PubChem (CID 66641033), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).