C23H22Cl2N4O3S2 — CID 66641359
2-N-[5-(3,4-dichlorophenyl)-4-hydroxythiophen-3-yl]-2-N-(ethylideneamino)-5-N-piperidin-1-ylthiophene-2,5-dicarboxamide (PubChem CID 66641359) has the molecular formula C23H22Cl2N4O3S2 and a molecular weight of 537.49 g/mol. Its IUPAC name is 2-N-[5-(3,4-dichlorophenyl)-4-hydroxythiophen-3-yl]-2-N-(ethylideneamino)-5-N-piperidin-1-ylthiophene-2,5-dicarboxamide.
| Compound Name | 2-N-[5-(3,4-dichlorophenyl)-4-hydroxythiophen-3-yl]-2-N-(ethylideneamino)-5-N-piperidin-1-ylthiophene-2,5-dicarboxamide |
|---|---|
| PubChem CID | 66641359 |
| Molecular Formula | C23H22Cl2N4O3S2 |
| Molecular Weight | 537.49 g/mol |
| Exact Mass | 536.05 |
| IUPAC Name | 2-N-[5-(3,4-dichlorophenyl)-4-hydroxythiophen-3-yl]-2-N-(ethylideneamino)-5-N-piperidin-1-ylthiophene-2,5-dicarboxamide |
| SMILES | CC=NN(C(=O)c1ccc(C(=O)NN2CCCCC2)s1)c1csc(-c2ccc(Cl)c(Cl)c2)c1O |
| InChI | InChI=1S/C23H22Cl2N4O3S2/c1-2-26-29(17-13-33-21(20(17)30)14-6-7-15(24)16(25)12-14)23(32)19-9-8-18(34-19)22(31)27-28-10-4-3-5-11-28/h2,6-9,12-13,30H,3-5,10-11H2,1H3,(H,27,31) |
| InChIKey | VFZRABKIHSDOKV-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 85.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.49 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|