About 1-oxo-1-phenyl-1λ5-phospholane-2,3-dione
1-oxo-1-phenyl-1λ5-phospholane-2,3-dione (PubChem CID 66641409) has the molecular formula C10H9O3P
and a molecular weight of 208.15 g/mol. Its IUPAC name is 1-oxo-1-phenyl-1λ5-phospholane-2,3-dione.
Molecular Properties
| Compound Name | 1-oxo-1-phenyl-1λ5-phospholane-2,3-dione |
| PubChem CID | 66641409 |
| Molecular Formula | C10H9O3P |
| Molecular Weight | 208.15 g/mol |
| Exact Mass | 208.03 |
| IUPAC Name | 1-oxo-1-phenyl-1λ5-phospholane-2,3-dione |
| SMILES | O=C1CCP(=O)(c2ccccc2)C1=O |
| InChI | InChI=1S/C10H9O3P/c11-9-6-7-14(13,10(9)12)8-4-2-1-3-5-8/h1-5H,6-7H2 |
| InChIKey | HSKTYFQWNLNPES-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.15 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 1-oxo-1-phenyl-1λ5-phospholane-2,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-oxo-1-phenyl-1λ5-phospholane-2,3-dione?
The IUPAC name of 1-oxo-1-phenyl-1λ5-phospholane-2,3-dione (CID 66641409) is 1-oxo-1-phenyl-1λ5-phospholane-2,3-dione.
What is the SMILES notation for 1-oxo-1-phenyl-1λ5-phospholane-2,3-dione?
The canonical SMILES for 1-oxo-1-phenyl-1λ5-phospholane-2,3-dione is O=C1CCP(=O)(c2ccccc2)C1=O.
What is the InChIKey of 1-oxo-1-phenyl-1λ5-phospholane-2,3-dione?
The InChIKey is HSKTYFQWNLNPES-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9O3P/c11-9-6-7-14(13,10(9)12)8-4-2-1-3-5-8/h1-5H,6-7H2.
What are the key properties of 1-oxo-1-phenyl-1λ5-phospholane-2,3-dione?
1-oxo-1-phenyl-1λ5-phospholane-2,3-dione has a molecular weight of 208.15 g/mol, XLogP of 1.17, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-oxo-1-phenyl-1λ5-phospholane-2,3-dione is sourced from PubChem (CID 66641409), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).