About 2-(3-methoxyphenyl)-1,4-dimethylbenzene
2-(3-methoxyphenyl)-1,4-dimethylbenzene (PubChem CID 66641424) has the molecular formula C15H16O
and a molecular weight of 212.29 g/mol. Its IUPAC name is 2-(3-methoxyphenyl)-1,4-dimethylbenzene.
Molecular Properties
| Compound Name | 2-(3-methoxyphenyl)-1,4-dimethylbenzene |
| PubChem CID | 66641424 |
| Molecular Formula | C15H16O |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.12 |
| IUPAC Name | 2-(3-methoxyphenyl)-1,4-dimethylbenzene |
| SMILES | COc1cccc(-c2cc(C)ccc2C)c1 |
| InChI | InChI=1S/C15H16O/c1-11-7-8-12(2)15(9-11)13-5-4-6-14(10-13)16-3/h4-10H,1-3H3 |
| InChIKey | HIDJWFLALDRZOF-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-(3-methoxyphenyl)-1,4-dimethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-methoxyphenyl)-1,4-dimethylbenzene?
The IUPAC name of 2-(3-methoxyphenyl)-1,4-dimethylbenzene (CID 66641424) is 2-(3-methoxyphenyl)-1,4-dimethylbenzene.
What is the SMILES notation for 2-(3-methoxyphenyl)-1,4-dimethylbenzene?
The canonical SMILES for 2-(3-methoxyphenyl)-1,4-dimethylbenzene is COc1cccc(-c2cc(C)ccc2C)c1.
What is the InChIKey of 2-(3-methoxyphenyl)-1,4-dimethylbenzene?
The InChIKey is HIDJWFLALDRZOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16O/c1-11-7-8-12(2)15(9-11)13-5-4-6-14(10-13)16-3/h4-10H,1-3H3.
What are the key properties of 2-(3-methoxyphenyl)-1,4-dimethylbenzene?
2-(3-methoxyphenyl)-1,4-dimethylbenzene has a molecular weight of 212.29 g/mol, XLogP of 3.98, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-methoxyphenyl)-1,4-dimethylbenzene is sourced from PubChem (CID 66641424), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).