C12H14N2 — CID 66641491
1,5a,6,6a,10a,10b-hexahydroazepino[4,5-b]indole (PubChem CID 66641491) has the molecular formula C12H14N2 and a molecular weight of 186.26 g/mol. Its IUPAC name is 1,5a,6,6a,10a,10b-hexahydroazepino[4,5-b]indole.
| Compound Name | 1,5a,6,6a,10a,10b-hexahydroazepino[4,5-b]indole |
|---|---|
| PubChem CID | 66641491 |
| Molecular Formula | C12H14N2 |
| Molecular Weight | 186.26 g/mol |
| Exact Mass | 186.12 |
| IUPAC Name | 1,5a,6,6a,10a,10b-hexahydroazepino[4,5-b]indole |
| SMILES | C1=CC2NC3C=CN=CCC3C2C=C1 |
| InChI | InChI=1S/C12H14N2/c1-2-4-11-9(3-1)10-5-7-13-8-6-12(10)14-11/h1-4,6-12,14H,5H2 |
| InChIKey | ISGSGDBCBJVJKG-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.26 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |