About 5-propan-2-yl-1,3-oxazole-2-carboxamide
5-propan-2-yl-1,3-oxazole-2-carboxamide (PubChem CID 66641604) has the molecular formula C7H10N2O2
and a molecular weight of 154.17 g/mol. Its IUPAC name is 5-propan-2-yl-1,3-oxazole-2-carboxamide.
Molecular Properties
| Compound Name | 5-propan-2-yl-1,3-oxazole-2-carboxamide |
| PubChem CID | 66641604 |
| Molecular Formula | C7H10N2O2 |
| Molecular Weight | 154.17 g/mol |
| Exact Mass | 154.07 |
| IUPAC Name | 5-propan-2-yl-1,3-oxazole-2-carboxamide |
| SMILES | CC(C)c1cnc(C(N)=O)o1 |
| InChI | InChI=1S/C7H10N2O2/c1-4(2)5-3-9-7(11-5)6(8)10/h3-4H,1-2H3,(H2,8,10) |
| InChIKey | XYUKFSDHTVWRDM-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 69.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.17 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-propan-2-yl-1,3-oxazole-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-propan-2-yl-1,3-oxazole-2-carboxamide?
The IUPAC name of 5-propan-2-yl-1,3-oxazole-2-carboxamide (CID 66641604) is 5-propan-2-yl-1,3-oxazole-2-carboxamide.
What is the SMILES notation for 5-propan-2-yl-1,3-oxazole-2-carboxamide?
The canonical SMILES for 5-propan-2-yl-1,3-oxazole-2-carboxamide is CC(C)c1cnc(C(N)=O)o1.
What is the InChIKey of 5-propan-2-yl-1,3-oxazole-2-carboxamide?
The InChIKey is XYUKFSDHTVWRDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2O2/c1-4(2)5-3-9-7(11-5)6(8)10/h3-4H,1-2H3,(H2,8,10).
What are the key properties of 5-propan-2-yl-1,3-oxazole-2-carboxamide?
5-propan-2-yl-1,3-oxazole-2-carboxamide has a molecular weight of 154.17 g/mol, XLogP of 0.90, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-propan-2-yl-1,3-oxazole-2-carboxamide is sourced from PubChem (CID 66641604), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).