C23H40INO — CID 66641639
(1R,4aR,5E)-5-[(3R)-3-iodo-3-methylpentylidene]-1,4a-dimethyl-N-(2-methylpropyl)-3,4,6,7,8,8a-hexahydro-2H-naphthalene-1-carboxamide (PubChem CID 66641639) has the molecular formula C23H40INO and a molecular weight of 473.48 g/mol. Its IUPAC name is (1R,4aR,5E)-5-[(3R)-3-iodo-3-methylpentylidene]-1,4a-dimethyl-N-(2-methylpropyl)-3,4,6,7,8,8a-hexahydro-2H-naphthalene-1-carboxamide.
| Compound Name | (1R,4aR,5E)-5-[(3R)-3-iodo-3-methylpentylidene]-1,4a-dimethyl-N-(2-methylpropyl)-3,4,6,7,8,8a-hexahydro-2H-naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 66641639 |
| Molecular Formula | C23H40INO |
| Molecular Weight | 473.48 g/mol |
| Exact Mass | 473.22 |
| IUPAC Name | (1R,4aR,5E)-5-[(3R)-3-iodo-3-methylpentylidene]-1,4a-dimethyl-N-(2-methylpropyl)-3,4,6,7,8,8a-hexahydro-2H-naphthalene-1-carboxamide |
| SMILES | CC[C@@](C)(I)C/C=C1\CCCC2[C@](C)(C(=O)NCC(C)C)CCC[C@@]12C |
| InChI | InChI=1S/C23H40INO/c1-7-21(4,24)15-12-18-10-8-11-19-22(18,5)13-9-14-23(19,6)20(26)25-16-17(2)3/h12,17,19H,7-11,13-16H2,1-6H3,(H,25,26)/b18-12+/t19?,21-,22+,23-/m1/s1 |
| InChIKey | RMKIBCLLQGBKAJ-YDAHSNHSSA-N |
| XLogP | 6.68 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.48 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|