C20H34O — CID 66641736
[(1R,4aS,8aR)-8a-ethyl-1,4a-dimethyl-7-methylidene-2,3,4,4b,5,6,8,9,10,10a-decahydrophenanthren-1-yl]methanol (PubChem CID 66641736) has the molecular formula C20H34O and a molecular weight of 290.49 g/mol. Its IUPAC name is [(1R,4aS,8aR)-8a-ethyl-1,4a-dimethyl-7-methylidene-2,3,4,4b,5,6,8,9,10,10a-decahydrophenanthren-1-yl]methanol.
| Compound Name | [(1R,4aS,8aR)-8a-ethyl-1,4a-dimethyl-7-methylidene-2,3,4,4b,5,6,8,9,10,10a-decahydrophenanthren-1-yl]methanol |
|---|---|
| PubChem CID | 66641736 |
| Molecular Formula | C20H34O |
| Molecular Weight | 290.49 g/mol |
| Exact Mass | 290.26 |
| IUPAC Name | [(1R,4aS,8aR)-8a-ethyl-1,4a-dimethyl-7-methylidene-2,3,4,4b,5,6,8,9,10,10a-decahydrophenanthren-1-yl]methanol |
| SMILES | C=C1CCC2[C@](CC)(CCC3[C@](C)(CO)CCC[C@]32C)C1 |
| InChI | InChI=1S/C20H34O/c1-5-20-12-9-16-18(3,14-21)10-6-11-19(16,4)17(20)8-7-15(2)13-20/h16-17,21H,2,5-14H2,1,3-4H3/t16?,17?,18-,19+,20+/m0/s1 |
| InChIKey | BPSTWSFPPAJJTH-GNWGEKMJSA-N |
| XLogP | 5.34 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.49 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|