C22H44N2O5Si — CID 66641805
tert-butyl (3aS,4S,6R,6aR)-4-(2-aminoethyl)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2,3a-trimethyl-6,6a-dihydro-4H-[1,3]dioxolo[4,5-c]pyrrole-5-carboxylate (PubChem CID 66641805) has the molecular formula C22H44N2O5Si and a molecular weight of 444.69 g/mol. Its IUPAC name is tert-butyl (3aS,4S,6R,6aR)-4-(2-aminoethyl)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2,3a-trimethyl-6,6a-dihydro-4H-[1,3]dioxolo[4,5-c]pyrrole-5-carboxylate.
| Compound Name | tert-butyl (3aS,4S,6R,6aR)-4-(2-aminoethyl)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2,3a-trimethyl-6,6a-dihydro-4H-[1,3]dioxolo[4,5-c]pyrrole-5-carboxylate |
|---|---|
| PubChem CID | 66641805 |
| Molecular Formula | C22H44N2O5Si |
| Molecular Weight | 444.69 g/mol |
| Exact Mass | 444.30 |
| IUPAC Name | tert-butyl (3aS,4S,6R,6aR)-4-(2-aminoethyl)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2,3a-trimethyl-6,6a-dihydro-4H-[1,3]dioxolo[4,5-c]pyrrole-5-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1[C@H](CO[Si](C)(C)C(C)(C)C)[C@H]2OC(C)(C)O[C@@]2(C)[C@@H]1CCN |
| InChI | InChI=1S/C22H44N2O5Si/c1-19(2,3)28-18(25)24-15(14-26-30(10,11)20(4,5)6)17-22(9,16(24)12-13-23)29-21(7,8)27-17/h15-17H,12-14,23H2,1-11H3/t15-,16+,17-,22+/m1/s1 |
| InChIKey | JREXWDBPTBKIKG-SVQXRNPESA-N |
| XLogP | 4.26 |
| TPSA | 83.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.69 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|