About 5-(4-fluorophenyl)-3,6-dihydro-2H-1,4-oxazine
5-(4-fluorophenyl)-3,6-dihydro-2H-1,4-oxazine (PubChem CID 66641810) has the molecular formula C10H10FNO
and a molecular weight of 179.19 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-3,6-dihydro-2H-1,4-oxazine.
Molecular Properties
| Compound Name | 5-(4-fluorophenyl)-3,6-dihydro-2H-1,4-oxazine |
| PubChem CID | 66641810 |
| Molecular Formula | C10H10FNO |
| Molecular Weight | 179.19 g/mol |
| Exact Mass | 179.07 |
| IUPAC Name | 5-(4-fluorophenyl)-3,6-dihydro-2H-1,4-oxazine |
| SMILES | Fc1ccc(C2=NCCOC2)cc1 |
| InChI | InChI=1S/C10H10FNO/c11-9-3-1-8(2-4-9)10-7-13-6-5-12-10/h1-4H,5-7H2 |
| InChIKey | SKSVKKOMMUDAGM-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.19 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-(4-fluorophenyl)-3,6-dihydro-2H-1,4-oxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-fluorophenyl)-3,6-dihydro-2H-1,4-oxazine?
The IUPAC name of 5-(4-fluorophenyl)-3,6-dihydro-2H-1,4-oxazine (CID 66641810) is 5-(4-fluorophenyl)-3,6-dihydro-2H-1,4-oxazine.
What is the SMILES notation for 5-(4-fluorophenyl)-3,6-dihydro-2H-1,4-oxazine?
The canonical SMILES for 5-(4-fluorophenyl)-3,6-dihydro-2H-1,4-oxazine is Fc1ccc(C2=NCCOC2)cc1.
What is the InChIKey of 5-(4-fluorophenyl)-3,6-dihydro-2H-1,4-oxazine?
The InChIKey is SKSVKKOMMUDAGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10FNO/c11-9-3-1-8(2-4-9)10-7-13-6-5-12-10/h1-4H,5-7H2.
What are the key properties of 5-(4-fluorophenyl)-3,6-dihydro-2H-1,4-oxazine?
5-(4-fluorophenyl)-3,6-dihydro-2H-1,4-oxazine has a molecular weight of 179.19 g/mol, XLogP of 1.64, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-fluorophenyl)-3,6-dihydro-2H-1,4-oxazine is sourced from PubChem (CID 66641810), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).