C26H30N2O5 — CID 66642249
N-[3-(2'-oxospiro[6H-furo[2,3-f][1,3]benzodioxole-7,3'-indole]-1'-yl)propyl]heptanamide (PubChem CID 66642249) has the molecular formula C26H30N2O5 and a molecular weight of 450.54 g/mol. Its IUPAC name is N-[3-(2'-oxospiro[6H-furo[2,3-f][1,3]benzodioxole-7,3'-indole]-1'-yl)propyl]heptanamide.
| Compound Name | N-[3-(2'-oxospiro[6H-furo[2,3-f][1,3]benzodioxole-7,3'-indole]-1'-yl)propyl]heptanamide |
|---|---|
| PubChem CID | 66642249 |
| Molecular Formula | C26H30N2O5 |
| Molecular Weight | 450.54 g/mol |
| Exact Mass | 450.22 |
| IUPAC Name | N-[3-(2'-oxospiro[6H-furo[2,3-f][1,3]benzodioxole-7,3'-indole]-1'-yl)propyl]heptanamide |
| SMILES | CCCCCCC(=O)NCCCN1C(=O)C2(COc3cc4c(cc32)OCO4)c2ccccc21 |
| InChI | InChI=1S/C26H30N2O5/c1-2-3-4-5-11-24(29)27-12-8-13-28-20-10-7-6-9-18(20)26(25(28)30)16-31-21-15-23-22(14-19(21)26)32-17-33-23/h6-7,9-10,14-15H,2-5,8,11-13,16-17H2,1H3,(H,27,29) |
| InChIKey | HPXHWCGZKLCGGP-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.54 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|