C35H36N2O7 — CID 66642316
tert-butyl 5-methoxy-3-(2'-oxo-1'-pentylspiro[6H-furo[2,3-f][1,3]benzodioxole-7,3'-indole]-4'-yl)indole-1-carboxylate (PubChem CID 66642316) has the molecular formula C35H36N2O7 and a molecular weight of 596.68 g/mol. Its IUPAC name is tert-butyl 5-methoxy-3-(2'-oxo-1'-pentylspiro[6H-furo[2,3-f][1,3]benzodioxole-7,3'-indole]-4'-yl)indole-1-carboxylate.
| Compound Name | tert-butyl 5-methoxy-3-(2'-oxo-1'-pentylspiro[6H-furo[2,3-f][1,3]benzodioxole-7,3'-indole]-4'-yl)indole-1-carboxylate |
|---|---|
| PubChem CID | 66642316 |
| Molecular Formula | C35H36N2O7 |
| Molecular Weight | 596.68 g/mol |
| Exact Mass | 596.25 |
| IUPAC Name | tert-butyl 5-methoxy-3-(2'-oxo-1'-pentylspiro[6H-furo[2,3-f][1,3]benzodioxole-7,3'-indole]-4'-yl)indole-1-carboxylate |
| SMILES | CCCCCN1C(=O)C2(COc3cc4c(cc32)OCO4)c2c(-c3cn(C(=O)OC(C)(C)C)c4ccc(OC)cc34)cccc21 |
| InChI | InChI=1S/C35H36N2O7/c1-6-7-8-14-36-27-11-9-10-22(24-18-37(33(39)44-34(2,3)4)26-13-12-21(40-5)15-23(24)26)31(27)35(32(36)38)19-41-28-17-30-29(16-25(28)35)42-20-43-30/h9-13,15-18H,6-8,14,19-20H2,1-5H3 |
| InChIKey | BAXXKWCEAUTVQU-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 88.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.68 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|