C20H16N2O4 — CID 66642446
4-(2'-oxospiro[6H-furo[2,3-f][1,3]benzodioxole-7,3'-indole]-1'-yl)butanenitrile (PubChem CID 66642446) has the molecular formula C20H16N2O4 and a molecular weight of 348.36 g/mol. Its IUPAC name is 4-(2'-oxospiro[6H-furo[2,3-f][1,3]benzodioxole-7,3'-indole]-1'-yl)butanenitrile.
| Compound Name | 4-(2'-oxospiro[6H-furo[2,3-f][1,3]benzodioxole-7,3'-indole]-1'-yl)butanenitrile |
|---|---|
| PubChem CID | 66642446 |
| Molecular Formula | C20H16N2O4 |
| Molecular Weight | 348.36 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | 4-(2'-oxospiro[6H-furo[2,3-f][1,3]benzodioxole-7,3'-indole]-1'-yl)butanenitrile |
| SMILES | N#CCCCN1C(=O)C2(COc3cc4c(cc32)OCO4)c2ccccc21 |
| InChI | InChI=1S/C20H16N2O4/c21-7-3-4-8-22-15-6-2-1-5-13(15)20(19(22)23)11-24-16-10-18-17(9-14(16)20)25-12-26-18/h1-2,5-6,9-10H,3-4,8,11-12H2 |
| InChIKey | KHKFHZFSMGPMIR-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 71.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.36 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|