C25H26N2O5 — CID 66642533
N-[3-(2'-oxospiro[6H-furo[2,3-f][1,3]benzodioxole-7,3'-indole]-1'-yl)propyl]cyclopentanecarboxamide (PubChem CID 66642533) has the molecular formula C25H26N2O5 and a molecular weight of 434.49 g/mol. Its IUPAC name is N-[3-(2'-oxospiro[6H-furo[2,3-f][1,3]benzodioxole-7,3'-indole]-1'-yl)propyl]cyclopentanecarboxamide.
| Compound Name | N-[3-(2'-oxospiro[6H-furo[2,3-f][1,3]benzodioxole-7,3'-indole]-1'-yl)propyl]cyclopentanecarboxamide |
|---|---|
| PubChem CID | 66642533 |
| Molecular Formula | C25H26N2O5 |
| Molecular Weight | 434.49 g/mol |
| Exact Mass | 434.18 |
| IUPAC Name | N-[3-(2'-oxospiro[6H-furo[2,3-f][1,3]benzodioxole-7,3'-indole]-1'-yl)propyl]cyclopentanecarboxamide |
| SMILES | O=C(NCCCN1C(=O)C2(COc3cc4c(cc32)OCO4)c2ccccc21)C1CCCC1 |
| InChI | InChI=1S/C25H26N2O5/c28-23(16-6-1-2-7-16)26-10-5-11-27-19-9-4-3-8-17(19)25(24(27)29)14-30-20-13-22-21(12-18(20)25)31-15-32-22/h3-4,8-9,12-13,16H,1-2,5-7,10-11,14-15H2,(H,26,28) |
| InChIKey | TXRHSKQPBPLKIR-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.49 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|