C12H24N2O2 — CID 66642887
(4-amino-1-methylcyclohexyl)-tert-butylcarbamic acid (PubChem CID 66642887) has the molecular formula C12H24N2O2 and a molecular weight of 228.34 g/mol. Its IUPAC name is (4-amino-1-methylcyclohexyl)-tert-butylcarbamic acid.
| Compound Name | (4-amino-1-methylcyclohexyl)-tert-butylcarbamic acid |
|---|---|
| PubChem CID | 66642887 |
| Molecular Formula | C12H24N2O2 |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.18 |
| IUPAC Name | (4-amino-1-methylcyclohexyl)-tert-butylcarbamic acid |
| SMILES | CC(C)(C)N(C(=O)O)C1(C)CCC(N)CC1 |
| InChI | InChI=1S/C12H24N2O2/c1-11(2,3)14(10(15)16)12(4)7-5-9(13)6-8-12/h9H,5-8,13H2,1-4H3,(H,15,16) |
| InChIKey | CNFRUIVMPSOKBL-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |