C17H20F4N2OS — CID 66643280
N-(3-butyl-5,5-dimethyl-1,3-thiazolidin-2-ylidene)-2-fluoro-5-(trifluoromethyl)benzamide (PubChem CID 66643280) has the molecular formula C17H20F4N2OS and a molecular weight of 376.42 g/mol. Its IUPAC name is N-(3-butyl-5,5-dimethyl-1,3-thiazolidin-2-ylidene)-2-fluoro-5-(trifluoromethyl)benzamide.
| Compound Name | N-(3-butyl-5,5-dimethyl-1,3-thiazolidin-2-ylidene)-2-fluoro-5-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 66643280 |
| Molecular Formula | C17H20F4N2OS |
| Molecular Weight | 376.42 g/mol |
| Exact Mass | 376.12 |
| IUPAC Name | N-(3-butyl-5,5-dimethyl-1,3-thiazolidin-2-ylidene)-2-fluoro-5-(trifluoromethyl)benzamide |
| SMILES | CCCCN1CC(C)(C)S/C1=N\C(=O)c1cc(C(F)(F)F)ccc1F |
| InChI | InChI=1S/C17H20F4N2OS/c1-4-5-8-23-10-16(2,3)25-15(23)22-14(24)12-9-11(17(19,20)21)6-7-13(12)18/h6-7,9H,4-5,8,10H2,1-3H3/b22-15- |
| InChIKey | QTNDRUPJZQLEKD-JCMHNJIXSA-N |
| XLogP | 4.97 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.42 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|