About 2-[2-[3-(5-fluoro-2-pyridinyl)-5-methyl-1,2-oxazol-4-yl]ethenyl]-1,3-thiazole-5-carboxylic acid
2-[2-[3-(5-fluoro-2-pyridinyl)-5-methyl-1,2-oxazol-4-yl]ethenyl]-1,3-thiazole-5-carboxylic acid (PubChem CID 66643611) has the molecular formula C15H10FN3O3S
and a molecular weight of 331.33 g/mol. Its IUPAC name is 2-[2-[3-(5-fluoro-2-pyridinyl)-5-methyl-1,2-oxazol-4-yl]ethenyl]-1,3-thiazole-5-carboxylic acid.
Molecular Properties
| Compound Name | 2-[2-[3-(5-fluoro-2-pyridinyl)-5-methyl-1,2-oxazol-4-yl]ethenyl]-1,3-thiazole-5-carboxylic acid |
| PubChem CID | 66643611 |
| Molecular Formula | C15H10FN3O3S |
| Molecular Weight | 331.33 g/mol |
| Exact Mass | 331.04 |
| IUPAC Name | 2-[2-[3-(5-fluoro-2-pyridinyl)-5-methyl-1,2-oxazol-4-yl]ethenyl]-1,3-thiazole-5-carboxylic acid |
| SMILES | Cc1onc(-c2ccc(F)cn2)c1C=Cc1ncc(C(=O)O)s1 |
| InChI | InChI=1S/C15H10FN3O3S/c1-8-10(3-5-13-18-7-12(23-13)15(20)21)14(19-22-8)11-4-2-9(16)6-17-11/h2-7H,1H3,(H,20,21) |
| InChIKey | ZMFIOXJKEHLHTQ-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 89.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.33 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[2-[3-(5-fluoro-2-pyridinyl)-5-methyl-1,2-oxazol-4-yl]ethenyl]-1,3-thiazole-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-[3-(5-fluoro-2-pyridinyl)-5-methyl-1,2-oxazol-4-yl]ethenyl]-1,3-thiazole-5-carboxylic acid?
The IUPAC name of 2-[2-[3-(5-fluoro-2-pyridinyl)-5-methyl-1,2-oxazol-4-yl]ethenyl]-1,3-thiazole-5-carboxylic acid (CID 66643611) is 2-[2-[3-(5-fluoro-2-pyridinyl)-5-methyl-1,2-oxazol-4-yl]ethenyl]-1,3-thiazole-5-carboxylic acid.
What is the SMILES notation for 2-[2-[3-(5-fluoro-2-pyridinyl)-5-methyl-1,2-oxazol-4-yl]ethenyl]-1,3-thiazole-5-carboxylic acid?
The canonical SMILES for 2-[2-[3-(5-fluoro-2-pyridinyl)-5-methyl-1,2-oxazol-4-yl]ethenyl]-1,3-thiazole-5-carboxylic acid is Cc1onc(-c2ccc(F)cn2)c1C=Cc1ncc(C(=O)O)s1.
What is the InChIKey of 2-[2-[3-(5-fluoro-2-pyridinyl)-5-methyl-1,2-oxazol-4-yl]ethenyl]-1,3-thiazole-5-carboxylic acid?
The InChIKey is ZMFIOXJKEHLHTQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10FN3O3S/c1-8-10(3-5-13-18-7-12(23-13)15(20)21)14(19-22-8)11-4-2-9(16)6-17-11/h2-7H,1H3,(H,20,21).
What are the key properties of 2-[2-[3-(5-fluoro-2-pyridinyl)-5-methyl-1,2-oxazol-4-yl]ethenyl]-1,3-thiazole-5-carboxylic acid?
2-[2-[3-(5-fluoro-2-pyridinyl)-5-methyl-1,2-oxazol-4-yl]ethenyl]-1,3-thiazole-5-carboxylic acid has a molecular weight of 331.33 g/mol, XLogP of 3.51, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[3-(5-fluoro-2-pyridinyl)-5-methyl-1,2-oxazol-4-yl]ethenyl]-1,3-thiazole-5-carboxylic acid is sourced from PubChem (CID 66643611), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).