C26H26N4O5 — CID 66643674
N-benzyl-N-[4-(1,3-oxazol-2-ylmethylamino)-3,4-dioxo-1-phenylbutan-2-yl]-5-oxopyrrolidine-2-carboxamide (PubChem CID 66643674) has the molecular formula C26H26N4O5 and a molecular weight of 474.52 g/mol. Its IUPAC name is N-benzyl-N-[4-(1,3-oxazol-2-ylmethylamino)-3,4-dioxo-1-phenylbutan-2-yl]-5-oxopyrrolidine-2-carboxamide.
| Compound Name | N-benzyl-N-[4-(1,3-oxazol-2-ylmethylamino)-3,4-dioxo-1-phenylbutan-2-yl]-5-oxopyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 66643674 |
| Molecular Formula | C26H26N4O5 |
| Molecular Weight | 474.52 g/mol |
| Exact Mass | 474.19 |
| IUPAC Name | N-benzyl-N-[4-(1,3-oxazol-2-ylmethylamino)-3,4-dioxo-1-phenylbutan-2-yl]-5-oxopyrrolidine-2-carboxamide |
| SMILES | O=C1CCC(C(=O)N(Cc2ccccc2)C(Cc2ccccc2)C(=O)C(=O)NCc2ncco2)N1 |
| InChI | InChI=1S/C26H26N4O5/c31-22-12-11-20(29-22)26(34)30(17-19-9-5-2-6-10-19)21(15-18-7-3-1-4-8-18)24(32)25(33)28-16-23-27-13-14-35-23/h1-10,13-14,20-21H,11-12,15-17H2,(H,28,33)(H,29,31) |
| InChIKey | RLAFFGXHWAANLE-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 121.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.52 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|