C23H22F3N3O5 — CID 66644581
(2R)-N-(4-amino-3,4-dioxo-1-phenylbutan-2-yl)-5-oxo-1-[[3-(trifluoromethoxy)phenyl]methyl]pyrrolidine-2-carboxamide (PubChem CID 66644581) has the molecular formula C23H22F3N3O5 and a molecular weight of 477.44 g/mol. Its IUPAC name is (2R)-N-(4-amino-3,4-dioxo-1-phenylbutan-2-yl)-5-oxo-1-[[3-(trifluoromethoxy)phenyl]methyl]pyrrolidine-2-carboxamide.
| Compound Name | (2R)-N-(4-amino-3,4-dioxo-1-phenylbutan-2-yl)-5-oxo-1-[[3-(trifluoromethoxy)phenyl]methyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 66644581 |
| Molecular Formula | C23H22F3N3O5 |
| Molecular Weight | 477.44 g/mol |
| Exact Mass | 477.15 |
| IUPAC Name | (2R)-N-(4-amino-3,4-dioxo-1-phenylbutan-2-yl)-5-oxo-1-[[3-(trifluoromethoxy)phenyl]methyl]pyrrolidine-2-carboxamide |
| SMILES | NC(=O)C(=O)C(Cc1ccccc1)NC(=O)[C@H]1CCC(=O)N1Cc1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C23H22F3N3O5/c24-23(25,26)34-16-8-4-7-15(11-16)13-29-18(9-10-19(29)30)22(33)28-17(20(31)21(27)32)12-14-5-2-1-3-6-14/h1-8,11,17-18H,9-10,12-13H2,(H2,27,32)(H,28,33)/t17?,18-/m1/s1 |
| InChIKey | WVTSCZLQOATXFT-QRWMCTBCSA-N |
| XLogP | 1.86 |
| TPSA | 118.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.44 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|