About 5-methyl-5-prop-2-enyl-1,3-dioxane-4,6-dione
5-methyl-5-prop-2-enyl-1,3-dioxane-4,6-dione (PubChem CID 66644615) has the molecular formula C8H10O4
and a molecular weight of 170.16 g/mol. Its IUPAC name is 5-methyl-5-prop-2-enyl-1,3-dioxane-4,6-dione.
Molecular Properties
| Compound Name | 5-methyl-5-prop-2-enyl-1,3-dioxane-4,6-dione |
| PubChem CID | 66644615 |
| Molecular Formula | C8H10O4 |
| Molecular Weight | 170.16 g/mol |
| Exact Mass | 170.06 |
| IUPAC Name | 5-methyl-5-prop-2-enyl-1,3-dioxane-4,6-dione |
| SMILES | C=CCC1(C)C(=O)OCOC1=O |
| InChI | InChI=1S/C8H10O4/c1-3-4-8(2)6(9)11-5-12-7(8)10/h3H,1,4-5H2,2H3 |
| InChIKey | URLLGFDJTASXDE-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.16 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-methyl-5-prop-2-enyl-1,3-dioxane-4,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-5-prop-2-enyl-1,3-dioxane-4,6-dione?
The IUPAC name of 5-methyl-5-prop-2-enyl-1,3-dioxane-4,6-dione (CID 66644615) is 5-methyl-5-prop-2-enyl-1,3-dioxane-4,6-dione.
What is the SMILES notation for 5-methyl-5-prop-2-enyl-1,3-dioxane-4,6-dione?
The canonical SMILES for 5-methyl-5-prop-2-enyl-1,3-dioxane-4,6-dione is C=CCC1(C)C(=O)OCOC1=O.
What is the InChIKey of 5-methyl-5-prop-2-enyl-1,3-dioxane-4,6-dione?
The InChIKey is URLLGFDJTASXDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O4/c1-3-4-8(2)6(9)11-5-12-7(8)10/h3H,1,4-5H2,2H3.
What are the key properties of 5-methyl-5-prop-2-enyl-1,3-dioxane-4,6-dione?
5-methyl-5-prop-2-enyl-1,3-dioxane-4,6-dione has a molecular weight of 170.16 g/mol, XLogP of 0.63, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-5-prop-2-enyl-1,3-dioxane-4,6-dione is sourced from PubChem (CID 66644615), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).