C21H23N3O5S — CID 66644716
N-(4-amino-3,4-dioxo-1-phenylbutan-2-yl)-2-benzyl-1,1-dioxo-1,2-thiazolidine-3-carboxamide (PubChem CID 66644716) has the molecular formula C21H23N3O5S and a molecular weight of 429.50 g/mol. Its IUPAC name is N-(4-amino-3,4-dioxo-1-phenylbutan-2-yl)-2-benzyl-1,1-dioxo-1,2-thiazolidine-3-carboxamide.
| Compound Name | N-(4-amino-3,4-dioxo-1-phenylbutan-2-yl)-2-benzyl-1,1-dioxo-1,2-thiazolidine-3-carboxamide |
|---|---|
| PubChem CID | 66644716 |
| Molecular Formula | C21H23N3O5S |
| Molecular Weight | 429.50 g/mol |
| Exact Mass | 429.14 |
| IUPAC Name | N-(4-amino-3,4-dioxo-1-phenylbutan-2-yl)-2-benzyl-1,1-dioxo-1,2-thiazolidine-3-carboxamide |
| SMILES | NC(=O)C(=O)C(Cc1ccccc1)NC(=O)C1CCS(=O)(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C21H23N3O5S/c22-20(26)19(25)17(13-15-7-3-1-4-8-15)23-21(27)18-11-12-30(28,29)24(18)14-16-9-5-2-6-10-16/h1-10,17-18H,11-14H2,(H2,22,26)(H,23,27) |
| InChIKey | PHFWBSXRDCWXMM-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 126.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.50 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|