C28H29N3O4 — CID 66645000
N-[4-anilino-4-(3,4-dioxocyclohexa-1,5-dien-1-yl)butan-2-yl]-1-benzyl-5-oxopyrrolidine-2-carboxamide (PubChem CID 66645000) has the molecular formula C28H29N3O4 and a molecular weight of 471.56 g/mol. Its IUPAC name is N-[4-anilino-4-(3,4-dioxocyclohexa-1,5-dien-1-yl)butan-2-yl]-1-benzyl-5-oxopyrrolidine-2-carboxamide.
| Compound Name | N-[4-anilino-4-(3,4-dioxocyclohexa-1,5-dien-1-yl)butan-2-yl]-1-benzyl-5-oxopyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 66645000 |
| Molecular Formula | C28H29N3O4 |
| Molecular Weight | 471.56 g/mol |
| Exact Mass | 471.22 |
| IUPAC Name | N-[4-anilino-4-(3,4-dioxocyclohexa-1,5-dien-1-yl)butan-2-yl]-1-benzyl-5-oxopyrrolidine-2-carboxamide |
| SMILES | CC(CC(Nc1ccccc1)C1=CC(=O)C(=O)C=C1)NC(=O)C1CCC(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C28H29N3O4/c1-19(29-28(35)24-13-15-27(34)31(24)18-20-8-4-2-5-9-20)16-23(30-22-10-6-3-7-11-22)21-12-14-25(32)26(33)17-21/h2-12,14,17,19,23-24,30H,13,15-16,18H2,1H3,(H,29,35) |
| InChIKey | SXDTVDYPYGPWRU-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.56 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|