About 2-[4-(6,7-dichloro-5-hydroxy-1-benzofuran-3-carbonyl)phenoxy]acetic acid
2-[4-(6,7-dichloro-5-hydroxy-1-benzofuran-3-carbonyl)phenoxy]acetic acid (PubChem CID 66645276) has the molecular formula C17H10Cl2O6
and a molecular weight of 381.17 g/mol. Its IUPAC name is 2-[4-(6,7-dichloro-5-hydroxy-1-benzofuran-3-carbonyl)phenoxy]acetic acid.
Molecular Properties
| Compound Name | 2-[4-(6,7-dichloro-5-hydroxy-1-benzofuran-3-carbonyl)phenoxy]acetic acid |
| PubChem CID | 66645276 |
| Molecular Formula | C17H10Cl2O6 |
| Molecular Weight | 381.17 g/mol |
| Exact Mass | 379.99 |
| IUPAC Name | 2-[4-(6,7-dichloro-5-hydroxy-1-benzofuran-3-carbonyl)phenoxy]acetic acid |
| SMILES | O=C(O)COc1ccc(C(=O)c2coc3c(Cl)c(Cl)c(O)cc23)cc1 |
| InChI | InChI=1S/C17H10Cl2O6/c18-14-12(20)5-10-11(6-25-17(10)15(14)19)16(23)8-1-3-9(4-2-8)24-7-13(21)22/h1-6,20H,7H2,(H,21,22) |
| InChIKey | SOWIJJWLBLKJHX-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 381.17 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[4-(6,7-dichloro-5-hydroxy-1-benzofuran-3-carbonyl)phenoxy]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(6,7-dichloro-5-hydroxy-1-benzofuran-3-carbonyl)phenoxy]acetic acid?
The IUPAC name of 2-[4-(6,7-dichloro-5-hydroxy-1-benzofuran-3-carbonyl)phenoxy]acetic acid (CID 66645276) is 2-[4-(6,7-dichloro-5-hydroxy-1-benzofuran-3-carbonyl)phenoxy]acetic acid.
What is the SMILES notation for 2-[4-(6,7-dichloro-5-hydroxy-1-benzofuran-3-carbonyl)phenoxy]acetic acid?
The canonical SMILES for 2-[4-(6,7-dichloro-5-hydroxy-1-benzofuran-3-carbonyl)phenoxy]acetic acid is O=C(O)COc1ccc(C(=O)c2coc3c(Cl)c(Cl)c(O)cc23)cc1.
What is the InChIKey of 2-[4-(6,7-dichloro-5-hydroxy-1-benzofuran-3-carbonyl)phenoxy]acetic acid?
The InChIKey is SOWIJJWLBLKJHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H10Cl2O6/c18-14-12(20)5-10-11(6-25-17(10)15(14)19)16(23)8-1-3-9(4-2-8)24-7-13(21)22/h1-6,20H,7H2,(H,21,22).
What are the key properties of 2-[4-(6,7-dichloro-5-hydroxy-1-benzofuran-3-carbonyl)phenoxy]acetic acid?
2-[4-(6,7-dichloro-5-hydroxy-1-benzofuran-3-carbonyl)phenoxy]acetic acid has a molecular weight of 381.17 g/mol, XLogP of 4.14, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(6,7-dichloro-5-hydroxy-1-benzofuran-3-carbonyl)phenoxy]acetic acid is sourced from PubChem (CID 66645276), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).