C29H49N5O6 — CID 66645815
(2S,4S,5S)-5-amino-N-(3-amino-2,2-dimethyl-3-oxopropyl)-4-hydroxy-6-[4-[2-(2-methoxyethoxy)phenyl]-2,2-dimethyl-5-oxopiperazin-1-yl]-2-propan-2-ylhexanamide (PubChem CID 66645815) has the molecular formula C29H49N5O6 and a molecular weight of 563.74 g/mol. Its IUPAC name is (2S,4S,5S)-5-amino-N-(3-amino-2,2-dimethyl-3-oxopropyl)-4-hydroxy-6-[4-[2-(2-methoxyethoxy)phenyl]-2,2-dimethyl-5-oxopiperazin-1-yl]-2-propan-2-ylhexanamide.
| Compound Name | (2S,4S,5S)-5-amino-N-(3-amino-2,2-dimethyl-3-oxopropyl)-4-hydroxy-6-[4-[2-(2-methoxyethoxy)phenyl]-2,2-dimethyl-5-oxopiperazin-1-yl]-2-propan-2-ylhexanamide |
|---|---|
| PubChem CID | 66645815 |
| Molecular Formula | C29H49N5O6 |
| Molecular Weight | 563.74 g/mol |
| Exact Mass | 563.37 |
| IUPAC Name | (2S,4S,5S)-5-amino-N-(3-amino-2,2-dimethyl-3-oxopropyl)-4-hydroxy-6-[4-[2-(2-methoxyethoxy)phenyl]-2,2-dimethyl-5-oxopiperazin-1-yl]-2-propan-2-ylhexanamide |
| SMILES | COCCOc1ccccc1N1CC(C)(C)N(C[C@H](N)[C@@H](O)CC(C(=O)NCC(C)(C)C(N)=O)C(C)C)CC1=O |
| InChI | InChI=1S/C29H49N5O6/c1-19(2)20(26(37)32-17-28(3,4)27(31)38)14-23(35)21(30)15-33-16-25(36)34(18-29(33,5)6)22-10-8-9-11-24(22)40-13-12-39-7/h8-11,19-21,23,35H,12-18,30H2,1-7H3,(H2,31,38)(H,32,37)/t20?,21-,23-/m0/s1 |
| InChIKey | SEWMEJJMYJQHTM-ZXNYFWILSA-N |
| XLogP | 1.12 |
| TPSA | 160.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.74 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|