C13H17IN2O — CID 66645905
N-[2-(3,4-dimethyl-4,5-dihydro-1,3-oxazol-3-ium-2-yl)ethenyl]aniline iodide (PubChem CID 66645905) has the molecular formula C13H17IN2O and a molecular weight of 344.20 g/mol. Its IUPAC name is N-[2-(3,4-dimethyl-4,5-dihydro-1,3-oxazol-3-ium-2-yl)ethenyl]aniline iodide.
| Compound Name | N-[2-(3,4-dimethyl-4,5-dihydro-1,3-oxazol-3-ium-2-yl)ethenyl]aniline iodide |
|---|---|
| PubChem CID | 66645905 |
| Molecular Formula | C13H17IN2O |
| Molecular Weight | 344.20 g/mol |
| Exact Mass | 344.04 |
| IUPAC Name | N-[2-(3,4-dimethyl-4,5-dihydro-1,3-oxazol-3-ium-2-yl)ethenyl]aniline iodide |
| SMILES | CC1COC(C=CNc2ccccc2)=[N+]1C.[I-] |
| InChI | InChI=1S/C13H16N2O.HI/c1-11-10-16-13(15(11)2)8-9-14-12-6-4-3-5-7-12;/h3-9,11H,10H2,1-2H3;1H |
| InChIKey | NUNHKJOTGLVGHA-UHFFFAOYSA-N |
| XLogP | -0.92 |
| TPSA | 24.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.20 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|