About 1H-imidazol-1-ium nitrate
1H-imidazol-1-ium nitrate (PubChem CID 66646199) has the molecular formula C3H5N3O3
and a molecular weight of 131.09 g/mol. Its IUPAC name is 1H-imidazol-1-ium nitrate.
Molecular Properties
| Compound Name | 1H-imidazol-1-ium nitrate |
| PubChem CID | 66646199 |
| Molecular Formula | C3H5N3O3 |
| Molecular Weight | 131.09 g/mol |
| Exact Mass | 131.03 |
| IUPAC Name | 1H-imidazol-1-ium nitrate |
| SMILES | C1=C[NH2+]C=N1.O=[N+]([O-])[O-] |
| InChI | InChI=1S/C3H4N2.NO3/c1-2-5-3-4-1;2-1(3)4/h1-3H,(H,4,5);/q;-1/p+1 |
| InChIKey | XSROMLOMDFTVMJ-UHFFFAOYSA-O |
| XLogP | -1.18 |
| TPSA | 95.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 131.09 |
| LogP ≤ 5 | -1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1H-imidazol-1-ium nitrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-imidazol-1-ium nitrate?
The IUPAC name of 1H-imidazol-1-ium nitrate (CID 66646199) is 1H-imidazol-1-ium nitrate.
What is the SMILES notation for 1H-imidazol-1-ium nitrate?
The canonical SMILES for 1H-imidazol-1-ium nitrate is C1=C[NH2+]C=N1.O=[N+]([O-])[O-].
What is the InChIKey of 1H-imidazol-1-ium nitrate?
The InChIKey is XSROMLOMDFTVMJ-UHFFFAOYSA-O. The full InChI is InChI=1S/C3H4N2.NO3/c1-2-5-3-4-1;2-1(3)4/h1-3H,(H,4,5);/q;-1/p+1.
What are the key properties of 1H-imidazol-1-ium nitrate?
1H-imidazol-1-ium nitrate has a molecular weight of 131.09 g/mol, XLogP of -1.18, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-imidazol-1-ium nitrate is sourced from PubChem (CID 66646199), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).