C28H27N3O5S — CID 66646875
3-[3-[3-[2-(cyclopentylsulfonylamino)benzoyl]-1H-pyrrolo[2,3-b]pyridin-5-yl]phenyl]propanoic acid (PubChem CID 66646875) has the molecular formula C28H27N3O5S and a molecular weight of 517.61 g/mol. Its IUPAC name is 3-[3-[3-[2-(cyclopentylsulfonylamino)benzoyl]-1H-pyrrolo[2,3-b]pyridin-5-yl]phenyl]propanoic acid.
| Compound Name | 3-[3-[3-[2-(cyclopentylsulfonylamino)benzoyl]-1H-pyrrolo[2,3-b]pyridin-5-yl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 66646875 |
| Molecular Formula | C28H27N3O5S |
| Molecular Weight | 517.61 g/mol |
| Exact Mass | 517.17 |
| IUPAC Name | 3-[3-[3-[2-(cyclopentylsulfonylamino)benzoyl]-1H-pyrrolo[2,3-b]pyridin-5-yl]phenyl]propanoic acid |
| SMILES | O=C(O)CCc1cccc(-c2cnc3[nH]cc(C(=O)c4ccccc4NS(=O)(=O)C4CCCC4)c3c2)c1 |
| InChI | InChI=1S/C28H27N3O5S/c32-26(33)13-12-18-6-5-7-19(14-18)20-15-23-24(17-30-28(23)29-16-20)27(34)22-10-3-4-11-25(22)31-37(35,36)21-8-1-2-9-21/h3-7,10-11,14-17,21,31H,1-2,8-9,12-13H2,(H,29,30)(H,32,33) |
| InChIKey | YBIVJTZKKYMHQS-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 129.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.61 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'} |
|---|