C26H34FN3O2 — CID 66647507
[1-[(4-fluorophenyl)methyl]-5,6,7,8-tetrahydro-4H-cyclohepta[d]pyrazol-3-yl] N-(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)carbamate (PubChem CID 66647507) has the molecular formula C26H34FN3O2 and a molecular weight of 439.58 g/mol. Its IUPAC name is [1-[(4-fluorophenyl)methyl]-5,6,7,8-tetrahydro-4H-cyclohepta[d]pyrazol-3-yl] N-(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)carbamate.
| Compound Name | [1-[(4-fluorophenyl)methyl]-5,6,7,8-tetrahydro-4H-cyclohepta[d]pyrazol-3-yl] N-(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)carbamate |
|---|---|
| PubChem CID | 66647507 |
| Molecular Formula | C26H34FN3O2 |
| Molecular Weight | 439.58 g/mol |
| Exact Mass | 439.26 |
| IUPAC Name | [1-[(4-fluorophenyl)methyl]-5,6,7,8-tetrahydro-4H-cyclohepta[d]pyrazol-3-yl] N-(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)carbamate |
| SMILES | CC12CCC(C1)C(C)(C)C2NC(=O)Oc1nn(Cc2ccc(F)cc2)c2c1CCCCC2 |
| InChI | InChI=1S/C26H34FN3O2/c1-25(2)18-13-14-26(3,15-18)23(25)28-24(31)32-22-20-7-5-4-6-8-21(20)30(29-22)16-17-9-11-19(27)12-10-17/h9-12,18,23H,4-8,13-16H2,1-3H3,(H,28,31) |
| InChIKey | DAVHIKXUMNGTAM-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.58 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |