C26H35N3O2 — CID 66647523
(1-benzyl-5,6,7,8-tetrahydro-4H-cyclohepta[d]pyrazol-3-yl) N-(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)carbamate (PubChem CID 66647523) has the molecular formula C26H35N3O2 and a molecular weight of 421.59 g/mol. Its IUPAC name is (1-benzyl-5,6,7,8-tetrahydro-4H-cyclohepta[d]pyrazol-3-yl) N-(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)carbamate.
| Compound Name | (1-benzyl-5,6,7,8-tetrahydro-4H-cyclohepta[d]pyrazol-3-yl) N-(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)carbamate |
|---|---|
| PubChem CID | 66647523 |
| Molecular Formula | C26H35N3O2 |
| Molecular Weight | 421.59 g/mol |
| Exact Mass | 421.27 |
| IUPAC Name | (1-benzyl-5,6,7,8-tetrahydro-4H-cyclohepta[d]pyrazol-3-yl) N-(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)carbamate |
| SMILES | CC12CCC(C1)C(C)(C)C2NC(=O)Oc1nn(Cc2ccccc2)c2c1CCCCC2 |
| InChI | InChI=1S/C26H35N3O2/c1-25(2)19-14-15-26(3,16-19)23(25)27-24(30)31-22-20-12-8-5-9-13-21(20)29(28-22)17-18-10-6-4-7-11-18/h4,6-7,10-11,19,23H,5,8-9,12-17H2,1-3H3,(H,27,30) |
| InChIKey | LEOHWJWIXJJUIK-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.59 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |