C32H28Cl2FN3O2 — CID 66647548
[(8E)-1-(2,4-dichlorophenyl)-8-[(4-fluorophenyl)methylidene]-4,5,6,7-tetrahydrocyclohepta[d]pyrazol-3-yl] N-(1,2,3,4-tetrahydronaphthalen-1-yl)carbamate (PubChem CID 66647548) has the molecular formula C32H28Cl2FN3O2 and a molecular weight of 576.50 g/mol. Its IUPAC name is [(8E)-1-(2,4-dichlorophenyl)-8-[(4-fluorophenyl)methylidene]-4,5,6,7-tetrahydrocyclohepta[d]pyrazol-3-yl] N-(1,2,3,4-tetrahydronaphthalen-1-yl)carbamate.
| Compound Name | [(8E)-1-(2,4-dichlorophenyl)-8-[(4-fluorophenyl)methylidene]-4,5,6,7-tetrahydrocyclohepta[d]pyrazol-3-yl] N-(1,2,3,4-tetrahydronaphthalen-1-yl)carbamate |
|---|---|
| PubChem CID | 66647548 |
| Molecular Formula | C32H28Cl2FN3O2 |
| Molecular Weight | 576.50 g/mol |
| Exact Mass | 575.15 |
| IUPAC Name | [(8E)-1-(2,4-dichlorophenyl)-8-[(4-fluorophenyl)methylidene]-4,5,6,7-tetrahydrocyclohepta[d]pyrazol-3-yl] N-(1,2,3,4-tetrahydronaphthalen-1-yl)carbamate |
| SMILES | O=C(NC1CCCc2ccccc21)Oc1nn(-c2ccc(Cl)cc2Cl)c2c1CCCC/C2=C\c1ccc(F)cc1 |
| InChI | InChI=1S/C32H28Cl2FN3O2/c33-23-14-17-29(27(34)19-23)38-30-22(18-20-12-15-24(35)16-13-20)7-2-4-10-26(30)31(37-38)40-32(39)36-28-11-5-8-21-6-1-3-9-25(21)28/h1,3,6,9,12-19,28H,2,4-5,7-8,10-11H2,(H,36,39)/b22-18+ |
| InChIKey | QQPHFNSBHHALJT-RELWKKBWSA-N |
| XLogP | 8.75 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.50 |
| LogP ≤ 5 | 8.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |