C31H26Cl2FN3O2 — CID 66647635
[(8E)-1-(2,4-dichlorophenyl)-8-[(4-fluorophenyl)methylidene]-4,5,6,7-tetrahydrocyclohepta[d]pyrazol-3-yl] N-[(1R)-2,3-dihydro-1H-inden-1-yl]carbamate (PubChem CID 66647635) has the molecular formula C31H26Cl2FN3O2 and a molecular weight of 562.47 g/mol. Its IUPAC name is [(8E)-1-(2,4-dichlorophenyl)-8-[(4-fluorophenyl)methylidene]-4,5,6,7-tetrahydrocyclohepta[d]pyrazol-3-yl] N-[(1R)-2,3-dihydro-1H-inden-1-yl]carbamate.
| Compound Name | [(8E)-1-(2,4-dichlorophenyl)-8-[(4-fluorophenyl)methylidene]-4,5,6,7-tetrahydrocyclohepta[d]pyrazol-3-yl] N-[(1R)-2,3-dihydro-1H-inden-1-yl]carbamate |
|---|---|
| PubChem CID | 66647635 |
| Molecular Formula | C31H26Cl2FN3O2 |
| Molecular Weight | 562.47 g/mol |
| Exact Mass | 561.14 |
| IUPAC Name | [(8E)-1-(2,4-dichlorophenyl)-8-[(4-fluorophenyl)methylidene]-4,5,6,7-tetrahydrocyclohepta[d]pyrazol-3-yl] N-[(1R)-2,3-dihydro-1H-inden-1-yl]carbamate |
| SMILES | O=C(N[C@@H]1CCc2ccccc21)Oc1nn(-c2ccc(Cl)cc2Cl)c2c1CCCC/C2=C\c1ccc(F)cc1 |
| InChI | InChI=1S/C31H26Cl2FN3O2/c32-22-12-16-28(26(33)18-22)37-29-21(17-19-9-13-23(34)14-10-19)6-2-4-8-25(29)30(36-37)39-31(38)35-27-15-11-20-5-1-3-7-24(20)27/h1,3,5,7,9-10,12-14,16-18,27H,2,4,6,8,11,15H2,(H,35,38)/b21-17+/t27-/m1/s1 |
| InChIKey | BOUJUIRHZPBJSV-PCLGYLGWSA-N |
| XLogP | 8.36 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.47 |
| LogP ≤ 5 | 8.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |