C32H44FN3O2 — CID 66647639
[1-cyclohexyl-8-[(3-fluorophenyl)methyl]-5,6,7,8-tetrahydro-4H-cyclohepta[d]pyrazol-3-yl] N-[(2S)-1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl]carbamate (PubChem CID 66647639) has the molecular formula C32H44FN3O2 and a molecular weight of 521.72 g/mol. Its IUPAC name is [1-cyclohexyl-8-[(3-fluorophenyl)methyl]-5,6,7,8-tetrahydro-4H-cyclohepta[d]pyrazol-3-yl] N-[(2S)-1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl]carbamate.
| Compound Name | [1-cyclohexyl-8-[(3-fluorophenyl)methyl]-5,6,7,8-tetrahydro-4H-cyclohepta[d]pyrazol-3-yl] N-[(2S)-1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl]carbamate |
|---|---|
| PubChem CID | 66647639 |
| Molecular Formula | C32H44FN3O2 |
| Molecular Weight | 521.72 g/mol |
| Exact Mass | 521.34 |
| IUPAC Name | [1-cyclohexyl-8-[(3-fluorophenyl)methyl]-5,6,7,8-tetrahydro-4H-cyclohepta[d]pyrazol-3-yl] N-[(2S)-1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl]carbamate |
| SMILES | CC12CCC(C1)C(C)(C)[C@H]2NC(=O)Oc1nn(C2CCCCC2)c2c1CCCCC2Cc1cccc(F)c1 |
| InChI | InChI=1S/C32H44FN3O2/c1-31(2)23-16-17-32(3,20-23)29(31)34-30(37)38-28-26-15-8-7-11-22(18-21-10-9-12-24(33)19-21)27(26)36(35-28)25-13-5-4-6-14-25/h9-10,12,19,22-23,25,29H,4-8,11,13-18,20H2,1-3H3,(H,34,37)/t22?,23?,29-,32?/m1/s1 |
| InChIKey | NPFQLEQOCYOCAU-QYGFZIKYSA-N |
| XLogP | 7.88 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.72 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |