C32H39N3O2 — CID 66647678
(1-benzyl-8-phenyl-5,6,7,8-tetrahydro-4H-cyclohepta[d]pyrazol-3-yl) N-[(2S)-1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl]carbamate (PubChem CID 66647678) has the molecular formula C32H39N3O2 and a molecular weight of 497.68 g/mol. Its IUPAC name is (1-benzyl-8-phenyl-5,6,7,8-tetrahydro-4H-cyclohepta[d]pyrazol-3-yl) N-[(2S)-1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl]carbamate.
| Compound Name | (1-benzyl-8-phenyl-5,6,7,8-tetrahydro-4H-cyclohepta[d]pyrazol-3-yl) N-[(2S)-1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl]carbamate |
|---|---|
| PubChem CID | 66647678 |
| Molecular Formula | C32H39N3O2 |
| Molecular Weight | 497.68 g/mol |
| Exact Mass | 497.30 |
| IUPAC Name | (1-benzyl-8-phenyl-5,6,7,8-tetrahydro-4H-cyclohepta[d]pyrazol-3-yl) N-[(2S)-1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl]carbamate |
| SMILES | CC12CCC(C1)C(C)(C)[C@H]2NC(=O)Oc1nn(Cc2ccccc2)c2c1CCCCC2c1ccccc1 |
| InChI | InChI=1S/C32H39N3O2/c1-31(2)24-18-19-32(3,20-24)29(31)33-30(36)37-28-26-17-11-10-16-25(23-14-8-5-9-15-23)27(26)35(34-28)21-22-12-6-4-7-13-22/h4-9,12-15,24-25,29H,10-11,16-21H2,1-3H3,(H,33,36)/t24?,25?,29-,32?/m1/s1 |
| InChIKey | AUQVURMFORYIOV-QCWHMEMVSA-N |
| XLogP | 7.09 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.68 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |