C21H46OSi2 — CID 66647881
2,2,3,3,6,6-hexapropyloxadisilinane (PubChem CID 66647881) has the molecular formula C21H46OSi2 and a molecular weight of 370.77 g/mol. Its IUPAC name is 2,2,3,3,6,6-hexapropyloxadisilinane.
| Compound Name | 2,2,3,3,6,6-hexapropyloxadisilinane |
|---|---|
| PubChem CID | 66647881 |
| Molecular Formula | C21H46OSi2 |
| Molecular Weight | 370.77 g/mol |
| Exact Mass | 370.31 |
| IUPAC Name | 2,2,3,3,6,6-hexapropyloxadisilinane |
| SMILES | CCCC1(CCC)CC[Si](CCC)(CCC)[Si](CCC)(CCC)O1 |
| InChI | InChI=1S/C21H46OSi2/c1-7-13-21(14-8-2)15-20-23(16-9-3,17-10-4)24(22-21,18-11-5)19-12-6/h7-20H2,1-6H3 |
| InChIKey | QDVHUTXNXYEALL-UHFFFAOYSA-N |
| XLogP | 7.86 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.77 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|