About CID 66647890
CID 66647890 (PubChem CID 66647890) has the molecular formula C8H4FSi
and a molecular weight of 147.20 g/mol.
Molecular Properties
| Compound Name | CID 66647890 |
| PubChem CID | 66647890 |
| Molecular Formula | C8H4FSi |
| Molecular Weight | 147.20 g/mol |
| Exact Mass | 147.01 |
| IUPAC Name | — |
| SMILES | Fc1ccccc1C#C[Si] |
| InChI | InChI=1S/C8H4FSi/c9-8-4-2-1-3-7(8)5-6-10/h1-4H |
| InChIKey | PJXDCJRWPSIBDR-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.20 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze CID 66647890 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 66647890?
The IUPAC name of CID 66647890 (CID 66647890) is not available.
What is the SMILES notation for CID 66647890?
The canonical SMILES for CID 66647890 is Fc1ccccc1C#C[Si].
What is the InChIKey of CID 66647890?
The InChIKey is PJXDCJRWPSIBDR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H4FSi/c9-8-4-2-1-3-7(8)5-6-10/h1-4H.
What are the key properties of CID 66647890?
CID 66647890 has a molecular weight of 147.20 g/mol, XLogP of 1.30, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 66647890 is sourced from PubChem (CID 66647890), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).