C15H31NO2Si — CID 66648095
1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinolin-1-yl-tert-butyl-dimethoxysilane (PubChem CID 66648095) has the molecular formula C15H31NO2Si and a molecular weight of 285.50 g/mol. Its IUPAC name is 1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinolin-1-yl-tert-butyl-dimethoxysilane.
| Compound Name | 1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinolin-1-yl-tert-butyl-dimethoxysilane |
|---|---|
| PubChem CID | 66648095 |
| Molecular Formula | C15H31NO2Si |
| Molecular Weight | 285.50 g/mol |
| Exact Mass | 285.21 |
| IUPAC Name | 1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinolin-1-yl-tert-butyl-dimethoxysilane |
| SMILES | CO[Si](OC)(C1NCCC2CCCCC21)C(C)(C)C |
| InChI | InChI=1S/C15H31NO2Si/c1-15(2,3)19(17-4,18-5)14-13-9-7-6-8-12(13)10-11-16-14/h12-14,16H,6-11H2,1-5H3 |
| InChIKey | FUESSYQLIHYNGK-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.50 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|