About cyclodecanesulfinate
cyclodecanesulfinate (PubChem CID 66648160) has the molecular formula C10H19O2S-
and a molecular weight of 203.33 g/mol. Its IUPAC name is cyclodecanesulfinate.
Molecular Properties
| Compound Name | cyclodecanesulfinate |
| PubChem CID | 66648160 |
| Molecular Formula | C10H19O2S- |
| Molecular Weight | 203.33 g/mol |
| Exact Mass | 203.11 |
| IUPAC Name | cyclodecanesulfinate |
| SMILES | O=S([O-])C1CCCCCCCCC1 |
| InChI | InChI=1S/C10H20O2S/c11-13(12)10-8-6-4-2-1-3-5-7-9-10/h10H,1-9H2,(H,11,12)/p-1 |
| InChIKey | XYCHPLPUUUGQGO-UHFFFAOYSA-M |
| XLogP | 2.76 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.33 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze cyclodecanesulfinate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclodecanesulfinate?
The IUPAC name of cyclodecanesulfinate (CID 66648160) is cyclodecanesulfinate.
What is the SMILES notation for cyclodecanesulfinate?
The canonical SMILES for cyclodecanesulfinate is O=S([O-])C1CCCCCCCCC1.
What is the InChIKey of cyclodecanesulfinate?
The InChIKey is XYCHPLPUUUGQGO-UHFFFAOYSA-M. The full InChI is InChI=1S/C10H20O2S/c11-13(12)10-8-6-4-2-1-3-5-7-9-10/h10H,1-9H2,(H,11,12)/p-1.
What are the key properties of cyclodecanesulfinate?
cyclodecanesulfinate has a molecular weight of 203.33 g/mol, XLogP of 2.76, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclodecanesulfinate is sourced from PubChem (CID 66648160), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).