C30H35F3N4O7S — CID 66648178
N-[2-[4-(4,5-dihydro-1H-imidazol-2-yl)phenyl]ethyl]-5-[[ethyl-(4-methoxy-2,6-dimethylphenyl)sulfonylamino]methyl]furan-3-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 66648178) has the molecular formula C30H35F3N4O7S and a molecular weight of 652.69 g/mol. Its IUPAC name is N-[2-[4-(4,5-dihydro-1H-imidazol-2-yl)phenyl]ethyl]-5-[[ethyl-(4-methoxy-2,6-dimethylphenyl)sulfonylamino]methyl]furan-3-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-[2-[4-(4,5-dihydro-1H-imidazol-2-yl)phenyl]ethyl]-5-[[ethyl-(4-methoxy-2,6-dimethylphenyl)sulfonylamino]methyl]furan-3-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 66648178 |
| Molecular Formula | C30H35F3N4O7S |
| Molecular Weight | 652.69 g/mol |
| Exact Mass | 652.22 |
| IUPAC Name | N-[2-[4-(4,5-dihydro-1H-imidazol-2-yl)phenyl]ethyl]-5-[[ethyl-(4-methoxy-2,6-dimethylphenyl)sulfonylamino]methyl]furan-3-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | CCN(Cc1cc(C(=O)NCCc2ccc(C3=NCCN3)cc2)co1)S(=O)(=O)c1c(C)cc(OC)cc1C.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C28H34N4O5S.C2HF3O2/c1-5-32(38(34,35)26-19(2)14-24(36-4)15-20(26)3)17-25-16-23(18-37-25)28(33)31-11-10-21-6-8-22(9-7-21)27-29-12-13-30-27;3-2(4,5)1(6)7/h6-9,14-16,18H,5,10-13,17H2,1-4H3,(H,29,30)(H,31,33);(H,6,7) |
| InChIKey | RNKZYTCYILFVKW-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 150.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.69 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |