About 1H-benzimidazole;3-phenyl-1,2-dihydrobenzimidazole
1H-benzimidazole;3-phenyl-1,2-dihydrobenzimidazole (PubChem CID 66648186) has the molecular formula C20H18N4
and a molecular weight of 314.39 g/mol. Its IUPAC name is 1H-benzimidazole;3-phenyl-1,2-dihydrobenzimidazole.
Molecular Properties
| Compound Name | 1H-benzimidazole;3-phenyl-1,2-dihydrobenzimidazole |
| PubChem CID | 66648186 |
| Molecular Formula | C20H18N4 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | 1H-benzimidazole;3-phenyl-1,2-dihydrobenzimidazole |
| SMILES | c1ccc(N2CNc3ccccc32)cc1.c1ccc2[nH]cnc2c1 |
| InChI | InChI=1S/C13H12N2.C7H6N2/c1-2-6-11(7-3-1)15-10-14-12-8-4-5-9-13(12)15;1-2-4-7-6(3-1)8-5-9-7/h1-9,14H,10H2;1-5H,(H,8,9) |
| InChIKey | VWOCINIWWUJZNL-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 43.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1H-benzimidazole;3-phenyl-1,2-dihydrobenzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-benzimidazole;3-phenyl-1,2-dihydrobenzimidazole?
The IUPAC name of 1H-benzimidazole;3-phenyl-1,2-dihydrobenzimidazole (CID 66648186) is 1H-benzimidazole;3-phenyl-1,2-dihydrobenzimidazole.
What is the SMILES notation for 1H-benzimidazole;3-phenyl-1,2-dihydrobenzimidazole?
The canonical SMILES for 1H-benzimidazole;3-phenyl-1,2-dihydrobenzimidazole is c1ccc(N2CNc3ccccc32)cc1.c1ccc2[nH]cnc2c1.
What is the InChIKey of 1H-benzimidazole;3-phenyl-1,2-dihydrobenzimidazole?
The InChIKey is VWOCINIWWUJZNL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12N2.C7H6N2/c1-2-6-11(7-3-1)15-10-14-12-8-4-5-9-13(12)15;1-2-4-7-6(3-1)8-5-9-7/h1-9,14H,10H2;1-5H,(H,8,9).
What are the key properties of 1H-benzimidazole;3-phenyl-1,2-dihydrobenzimidazole?
1H-benzimidazole;3-phenyl-1,2-dihydrobenzimidazole has a molecular weight of 314.39 g/mol, XLogP of 4.77, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-benzimidazole;3-phenyl-1,2-dihydrobenzimidazole is sourced from PubChem (CID 66648186), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).