C22H28N4O3S — CID 66648268
N-[2-(dimethylamino)ethyl]-4-(5,5-dimethyl-7-oxo-4,6-dihydro-1,3-benzothiazol-2-yl)-2,3-dihydro-1,4-benzoxazine-7-carboxamide (PubChem CID 66648268) has the molecular formula C22H28N4O3S and a molecular weight of 428.56 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-4-(5,5-dimethyl-7-oxo-4,6-dihydro-1,3-benzothiazol-2-yl)-2,3-dihydro-1,4-benzoxazine-7-carboxamide.
| Compound Name | N-[2-(dimethylamino)ethyl]-4-(5,5-dimethyl-7-oxo-4,6-dihydro-1,3-benzothiazol-2-yl)-2,3-dihydro-1,4-benzoxazine-7-carboxamide |
|---|---|
| PubChem CID | 66648268 |
| Molecular Formula | C22H28N4O3S |
| Molecular Weight | 428.56 g/mol |
| Exact Mass | 428.19 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-4-(5,5-dimethyl-7-oxo-4,6-dihydro-1,3-benzothiazol-2-yl)-2,3-dihydro-1,4-benzoxazine-7-carboxamide |
| SMILES | CN(C)CCNC(=O)c1ccc2c(c1)OCCN2c1nc2c(s1)C(=O)CC(C)(C)C2 |
| InChI | InChI=1S/C22H28N4O3S/c1-22(2)12-15-19(17(27)13-22)30-21(24-15)26-9-10-29-18-11-14(5-6-16(18)26)20(28)23-7-8-25(3)4/h5-6,11H,7-10,12-13H2,1-4H3,(H,23,28) |
| InChIKey | AMAYPXCZVVRBQL-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.56 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |