C26H26F3NO3S — CID 66648552
4-[[3-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)-4-(trifluoromethoxy)phenyl]methylidene]-1,3-thiazolidine-2,5-dione (PubChem CID 66648552) has the molecular formula C26H26F3NO3S and a molecular weight of 489.56 g/mol. Its IUPAC name is 4-[[3-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)-4-(trifluoromethoxy)phenyl]methylidene]-1,3-thiazolidine-2,5-dione.
| Compound Name | 4-[[3-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)-4-(trifluoromethoxy)phenyl]methylidene]-1,3-thiazolidine-2,5-dione |
|---|---|
| PubChem CID | 66648552 |
| Molecular Formula | C26H26F3NO3S |
| Molecular Weight | 489.56 g/mol |
| Exact Mass | 489.16 |
| IUPAC Name | 4-[[3-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)-4-(trifluoromethoxy)phenyl]methylidene]-1,3-thiazolidine-2,5-dione |
| SMILES | Cc1cc2c(cc1-c1cc(C=C3NC(=O)SC3=O)ccc1OC(F)(F)F)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C26H26F3NO3S/c1-14-10-18-19(25(4,5)9-8-24(18,2)3)13-16(14)17-11-15(6-7-21(17)33-26(27,28)29)12-20-22(31)34-23(32)30-20/h6-7,10-13H,8-9H2,1-5H3,(H,30,32) |
| InChIKey | UIEYCHMDDWJEFT-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.56 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|